C18H20F2N4O2S — CID 155878300
(4aS,7aS)-N-(3,4-difluorophenyl)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-6-carboxamide (PubChem CID 155878300) has the molecular formula C18H20F2N4O2S and a molecular weight of 394.45 g/mol. Its IUPAC name is (4aS,7aS)-N-(3,4-difluorophenyl)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-6-carboxamide.
| Compound Name | (4aS,7aS)-N-(3,4-difluorophenyl)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-6-carboxamide |
|---|---|
| PubChem CID | 155878300 |
| Molecular Formula | C18H20F2N4O2S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | (4aS,7aS)-N-(3,4-difluorophenyl)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-6-carboxamide |
| SMILES | Cc1nc(CN2CCO[C@H]3CN(C(=O)Nc4ccc(F)c(F)c4)C[C@@H]32)cs1 |
| InChI | InChI=1S/C18H20F2N4O2S/c1-11-21-13(10-27-11)7-23-4-5-26-17-9-24(8-16(17)23)18(25)22-12-2-3-14(19)15(20)6-12/h2-3,6,10,16-17H,4-5,7-9H2,1H3,(H,22,25)/t16-,17-/m0/s1 |
| InChIKey | DIQSNONTDSHVTL-IRXDYDNUSA-N |
| XLogP | 2.85 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |