C19H27F2N3O — CID 155877141
(3aR,8aS)-N-(3,4-difluorophenyl)-6-(2-methylpropyl)-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepine-2-carboxamide (PubChem CID 155877141) has the molecular formula C19H27F2N3O and a molecular weight of 351.44 g/mol. Its IUPAC name is (3aR,8aS)-N-(3,4-difluorophenyl)-6-(2-methylpropyl)-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepine-2-carboxamide.
| Compound Name | (3aR,8aS)-N-(3,4-difluorophenyl)-6-(2-methylpropyl)-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepine-2-carboxamide |
|---|---|
| PubChem CID | 155877141 |
| Molecular Formula | C19H27F2N3O |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | (3aR,8aS)-N-(3,4-difluorophenyl)-6-(2-methylpropyl)-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepine-2-carboxamide |
| SMILES | CC(C)CN1CC[C@@H]2CN(C(=O)Nc3ccc(F)c(F)c3)C[C@@H]2CC1 |
| InChI | InChI=1S/C19H27F2N3O/c1-13(2)10-23-7-5-14-11-24(12-15(14)6-8-23)19(25)22-16-3-4-17(20)18(21)9-16/h3-4,9,13-15H,5-8,10-12H2,1-2H3,(H,22,25)/t14-,15+ |
| InChIKey | WMPBCDCHFCJJIN-GASCZTMLSA-N |
| XLogP | 3.80 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |