C27H27N3O4 — CID 56522106
2-(2,5-dioxo-3-phenylimidazolidin-1-yl)-N-ethyl-N-[(4-phenylmethoxyphenyl)methyl]acetamide (PubChem CID 56522106) has the molecular formula C27H27N3O4 and a molecular weight of 457.53 g/mol. Its IUPAC name is 2-(2,5-dioxo-3-phenylimidazolidin-1-yl)-N-ethyl-N-[(4-phenylmethoxyphenyl)methyl]acetamide.
| Compound Name | 2-(2,5-dioxo-3-phenylimidazolidin-1-yl)-N-ethyl-N-[(4-phenylmethoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 56522106 |
| Molecular Formula | C27H27N3O4 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 2-(2,5-dioxo-3-phenylimidazolidin-1-yl)-N-ethyl-N-[(4-phenylmethoxyphenyl)methyl]acetamide |
| SMILES | CCN(Cc1ccc(OCc2ccccc2)cc1)C(=O)CN1C(=O)CN(c2ccccc2)C1=O |
| InChI | InChI=1S/C27H27N3O4/c1-2-28(17-21-13-15-24(16-14-21)34-20-22-9-5-3-6-10-22)25(31)18-30-26(32)19-29(27(30)33)23-11-7-4-8-12-23/h3-16H,2,17-20H2,1H3 |
| InChIKey | KRBTUWJIFSXSHH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|