C23H25N3O5 — CID 9341883
N-ethyl-2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-[(4-phenylmethoxyphenyl)methyl]acetamide (PubChem CID 9341883) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is N-ethyl-2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-[(4-phenylmethoxyphenyl)methyl]acetamide.
| Compound Name | N-ethyl-2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-[(4-phenylmethoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 9341883 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | N-ethyl-2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-[(4-phenylmethoxyphenyl)methyl]acetamide |
| SMILES | CCN(Cc1ccc(OCc2ccccc2)cc1)C(=O)CN1C(=O)C(=O)N(CC)C1=O |
| InChI | InChI=1S/C23H25N3O5/c1-3-24(20(27)15-26-22(29)21(28)25(4-2)23(26)30)14-17-10-12-19(13-11-17)31-16-18-8-6-5-7-9-18/h5-13H,3-4,14-16H2,1-2H3 |
| InChIKey | OCFUDLHAVPQJNG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|