C20H21N5O4S — CID 56524142
(E)-N-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-3-[4-(methylsulfamoyl)phenyl]prop-2-enamide (PubChem CID 56524142) has the molecular formula C20H21N5O4S and a molecular weight of 427.49 g/mol. Its IUPAC name is (E)-N-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-3-[4-(methylsulfamoyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-3-[4-(methylsulfamoyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 56524142 |
| Molecular Formula | C20H21N5O4S |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | (E)-N-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-3-[4-(methylsulfamoyl)phenyl]prop-2-enamide |
| SMILES | CNS(=O)(=O)c1ccc(/C=C/C(=O)NCc2nc(-c3ccc(OC)cc3)n[nH]2)cc1 |
| InChI | InChI=1S/C20H21N5O4S/c1-21-30(27,28)17-10-3-14(4-11-17)5-12-19(26)22-13-18-23-20(25-24-18)15-6-8-16(29-2)9-7-15/h3-12,21H,13H2,1-2H3,(H,22,26)(H,23,24,25)/b12-5+ |
| InChIKey | JBZJIBKMCOXSJH-LFYBBSHMSA-N |
| XLogP | 1.72 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|