C21H18N4O5 — CID 56524279
N-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-(2-oxochromen-7-yl)oxyacetamide (PubChem CID 56524279) has the molecular formula C21H18N4O5 and a molecular weight of 406.40 g/mol. Its IUPAC name is N-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-(2-oxochromen-7-yl)oxyacetamide.
| Compound Name | N-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-(2-oxochromen-7-yl)oxyacetamide |
|---|---|
| PubChem CID | 56524279 |
| Molecular Formula | C21H18N4O5 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | N-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-2-(2-oxochromen-7-yl)oxyacetamide |
| SMILES | COc1ccc(-c2n[nH]c(CNC(=O)COc3ccc4ccc(=O)oc4c3)n2)cc1 |
| InChI | InChI=1S/C21H18N4O5/c1-28-15-6-3-14(4-7-15)21-23-18(24-25-21)11-22-19(26)12-29-16-8-2-13-5-9-20(27)30-17(13)10-16/h2-10H,11-12H2,1H3,(H,22,26)(H,23,24,25) |
| InChIKey | KGVOEZCKVAPWLW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 119.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|