C21H20N2O5 — CID 46401405
N,N-dimethyl-3-[[[2-(2-oxochromen-7-yl)oxyacetyl]amino]methyl]benzamide (PubChem CID 46401405) has the molecular formula C21H20N2O5 and a molecular weight of 380.40 g/mol. Its IUPAC name is N,N-dimethyl-3-[[[2-(2-oxochromen-7-yl)oxyacetyl]amino]methyl]benzamide.
| Compound Name | N,N-dimethyl-3-[[[2-(2-oxochromen-7-yl)oxyacetyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 46401405 |
| Molecular Formula | C21H20N2O5 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | N,N-dimethyl-3-[[[2-(2-oxochromen-7-yl)oxyacetyl]amino]methyl]benzamide |
| SMILES | CN(C)C(=O)c1cccc(CNC(=O)COc2ccc3ccc(=O)oc3c2)c1 |
| InChI | InChI=1S/C21H20N2O5/c1-23(2)21(26)16-5-3-4-14(10-16)12-22-19(24)13-27-17-8-6-15-7-9-20(25)28-18(15)11-17/h3-11H,12-13H2,1-2H3,(H,22,24) |
| InChIKey | PJDNOYWQUITQGO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|