C28H23N3O4 — CID 26117124
N-[(1-benzyl-3-phenylpyrazol-4-yl)methyl]-2-(2-oxochromen-7-yl)oxyacetamide (PubChem CID 26117124) has the molecular formula C28H23N3O4 and a molecular weight of 465.51 g/mol. Its IUPAC name is N-[(1-benzyl-3-phenylpyrazol-4-yl)methyl]-2-(2-oxochromen-7-yl)oxyacetamide.
| Compound Name | N-[(1-benzyl-3-phenylpyrazol-4-yl)methyl]-2-(2-oxochromen-7-yl)oxyacetamide |
|---|---|
| PubChem CID | 26117124 |
| Molecular Formula | C28H23N3O4 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | N-[(1-benzyl-3-phenylpyrazol-4-yl)methyl]-2-(2-oxochromen-7-yl)oxyacetamide |
| SMILES | O=C(COc1ccc2ccc(=O)oc2c1)NCc1cn(Cc2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C28H23N3O4/c32-26(19-34-24-13-11-21-12-14-27(33)35-25(21)15-24)29-16-23-18-31(17-20-7-3-1-4-8-20)30-28(23)22-9-5-2-6-10-22/h1-15,18H,16-17,19H2,(H,29,32) |
| InChIKey | DITRHBQWSFQHNT-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|