C25H28N4O2 — CID 56526707
N-benzhydryl-3-[methyl-[2-[(4-methyl-2-pyridinyl)amino]-2-oxoethyl]amino]propanamide (PubChem CID 56526707) has the molecular formula C25H28N4O2 and a molecular weight of 416.53 g/mol. Its IUPAC name is N-benzhydryl-3-[methyl-[2-[(4-methyl-2-pyridinyl)amino]-2-oxoethyl]amino]propanamide.
| Compound Name | N-benzhydryl-3-[methyl-[2-[(4-methyl-2-pyridinyl)amino]-2-oxoethyl]amino]propanamide |
|---|---|
| PubChem CID | 56526707 |
| Molecular Formula | C25H28N4O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | N-benzhydryl-3-[methyl-[2-[(4-methyl-2-pyridinyl)amino]-2-oxoethyl]amino]propanamide |
| SMILES | Cc1ccnc(NC(=O)CN(C)CCC(=O)NC(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C25H28N4O2/c1-19-13-15-26-22(17-19)27-24(31)18-29(2)16-14-23(30)28-25(20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-13,15,17,25H,14,16,18H2,1-2H3,(H,28,30)(H,26,27,31) |
| InChIKey | MUZYRPREAILLIL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |