C19H21ClF2N2O — CID 56527010
2-[3-(4-chlorophenyl)pentan-3-ylamino]-N-(2,4-difluorophenyl)acetamide (PubChem CID 56527010) has the molecular formula C19H21ClF2N2O and a molecular weight of 366.84 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)pentan-3-ylamino]-N-(2,4-difluorophenyl)acetamide.
| Compound Name | 2-[3-(4-chlorophenyl)pentan-3-ylamino]-N-(2,4-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 56527010 |
| Molecular Formula | C19H21ClF2N2O |
| Molecular Weight | 366.84 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 2-[3-(4-chlorophenyl)pentan-3-ylamino]-N-(2,4-difluorophenyl)acetamide |
| SMILES | CCC(CC)(NCC(=O)Nc1ccc(F)cc1F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H21ClF2N2O/c1-3-19(4-2,13-5-7-14(20)8-6-13)23-12-18(25)24-17-10-9-15(21)11-16(17)22/h5-11,23H,3-4,12H2,1-2H3,(H,24,25) |
| InChIKey | OLIHOIGUVNSQQN-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.84 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |