C15H16F3N3O5S — CID 56528909
2,2,2-trifluoroethyl N-[2-[[5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]ethyl]carbamate (PubChem CID 56528909) has the molecular formula C15H16F3N3O5S and a molecular weight of 407.37 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-[2-[[5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]ethyl]carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-[2-[[5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]ethyl]carbamate |
|---|---|
| PubChem CID | 56528909 |
| Molecular Formula | C15H16F3N3O5S |
| Molecular Weight | 407.37 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | 2,2,2-trifluoroethyl N-[2-[[5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]ethyl]carbamate |
| SMILES | COc1ccc(-c2nnc(SCCNC(=O)OCC(F)(F)F)o2)cc1OC |
| InChI | InChI=1S/C15H16F3N3O5S/c1-23-10-4-3-9(7-11(10)24-2)12-20-21-14(26-12)27-6-5-19-13(22)25-8-15(16,17)18/h3-4,7H,5-6,8H2,1-2H3,(H,19,22) |
| InChIKey | BGTBQQYIEKTZDF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|