C20H22N4O3S — CID 56528943
2-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanyl-1-(4-methoxyphenyl)butan-1-one (PubChem CID 56528943) has the molecular formula C20H22N4O3S and a molecular weight of 398.49 g/mol. Its IUPAC name is 2-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanyl-1-(4-methoxyphenyl)butan-1-one.
| Compound Name | 2-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanyl-1-(4-methoxyphenyl)butan-1-one |
|---|---|
| PubChem CID | 56528943 |
| Molecular Formula | C20H22N4O3S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 2-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanyl-1-(4-methoxyphenyl)butan-1-one |
| SMILES | CCOc1ccccc1-n1nnnc1SC(CC)C(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H22N4O3S/c1-4-18(19(25)14-10-12-15(26-3)13-11-14)28-20-21-22-23-24(20)16-8-6-7-9-17(16)27-5-2/h6-13,18H,4-5H2,1-3H3 |
| InChIKey | ZZHCWDWALBLEFE-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |