C22H28N4O2S — CID 8894003
(2S)-1-(1-adamantyl)-2-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanylpropan-1-one (PubChem CID 8894003) has the molecular formula C22H28N4O2S and a molecular weight of 412.56 g/mol. Its IUPAC name is (2S)-1-(1-adamantyl)-2-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanylpropan-1-one.
| Compound Name | (2S)-1-(1-adamantyl)-2-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanylpropan-1-one |
|---|---|
| PubChem CID | 8894003 |
| Molecular Formula | C22H28N4O2S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | (2S)-1-(1-adamantyl)-2-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanylpropan-1-one |
| SMILES | CCOc1ccccc1-n1nnnc1S[C@@H](C)C(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H28N4O2S/c1-3-28-19-7-5-4-6-18(19)26-21(23-24-25-26)29-14(2)20(27)22-11-15-8-16(12-22)10-17(9-15)13-22/h4-7,14-17H,3,8-13H2,1-2H3/t14-,15?,16?,17?,22?/m0/s1 |
| InChIKey | WBZQPCNWFFQBDZ-HIGJEIRPSA-N |
| XLogP | 4.33 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |