C23H31N5O2S — CID 16536991
N-[1-(1-adamantyl)ethyl]-2-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 16536991) has the molecular formula C23H31N5O2S and a molecular weight of 441.60 g/mol. Its IUPAC name is N-[1-(1-adamantyl)ethyl]-2-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-[1-(1-adamantyl)ethyl]-2-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 16536991 |
| Molecular Formula | C23H31N5O2S |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | N-[1-(1-adamantyl)ethyl]-2-[1-(2-ethoxyphenyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | CCOc1ccccc1-n1nnnc1SCC(=O)NC(C)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H31N5O2S/c1-3-30-20-7-5-4-6-19(20)28-22(25-26-27-28)31-14-21(29)24-15(2)23-11-16-8-17(12-23)10-18(9-16)13-23/h4-7,15-18H,3,8-14H2,1-2H3,(H,24,29) |
| InChIKey | NWZJJAPSOSDLMW-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |