C16H24N4OS — CID 40938645
(2R)-1-(1-adamantyl)-2-(1-ethyltetrazol-5-yl)sulfanylpropan-1-one (PubChem CID 40938645) has the molecular formula C16H24N4OS and a molecular weight of 320.46 g/mol. Its IUPAC name is (2R)-1-(1-adamantyl)-2-(1-ethyltetrazol-5-yl)sulfanylpropan-1-one.
| Compound Name | (2R)-1-(1-adamantyl)-2-(1-ethyltetrazol-5-yl)sulfanylpropan-1-one |
|---|---|
| PubChem CID | 40938645 |
| Molecular Formula | C16H24N4OS |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | (2R)-1-(1-adamantyl)-2-(1-ethyltetrazol-5-yl)sulfanylpropan-1-one |
| SMILES | CCn1nnnc1S[C@H](C)C(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C16H24N4OS/c1-3-20-15(17-18-19-20)22-10(2)14(21)16-7-11-4-12(8-16)6-13(5-11)9-16/h10-13H,3-9H2,1-2H3/t10-,11?,12?,13?,16?/m1/s1 |
| InChIKey | WUKGFWYBOACMTM-GYPVXTSCSA-N |
| XLogP | 2.96 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |