C7H12N6O2S — CID 41236820
(2S)-N-carbamoyl-2-(1-ethyltetrazol-5-yl)sulfanylpropanamide (PubChem CID 41236820) has the molecular formula C7H12N6O2S and a molecular weight of 244.28 g/mol. Its IUPAC name is (2S)-N-carbamoyl-2-(1-ethyltetrazol-5-yl)sulfanylpropanamide.
| Compound Name | (2S)-N-carbamoyl-2-(1-ethyltetrazol-5-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 41236820 |
| Molecular Formula | C7H12N6O2S |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | (2S)-N-carbamoyl-2-(1-ethyltetrazol-5-yl)sulfanylpropanamide |
| SMILES | CCn1nnnc1S[C@@H](C)C(=O)NC(N)=O |
| InChI | InChI=1S/C7H12N6O2S/c1-3-13-7(10-11-12-13)16-4(2)5(14)9-6(8)15/h4H,3H2,1-2H3,(H3,8,9,14,15)/t4-/m0/s1 |
| InChIKey | IHKLUWXXWRQEPQ-BYPYZUCNSA-N |
| XLogP | -0.63 |
| TPSA | 115.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |