C11H20N6O2S — CID 42923555
N-(ethylcarbamoyl)-2-[1-(2-methylpropyl)tetrazol-5-yl]sulfanylpropanamide (PubChem CID 42923555) has the molecular formula C11H20N6O2S and a molecular weight of 300.39 g/mol. Its IUPAC name is N-(ethylcarbamoyl)-2-[1-(2-methylpropyl)tetrazol-5-yl]sulfanylpropanamide.
| Compound Name | N-(ethylcarbamoyl)-2-[1-(2-methylpropyl)tetrazol-5-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 42923555 |
| Molecular Formula | C11H20N6O2S |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | N-(ethylcarbamoyl)-2-[1-(2-methylpropyl)tetrazol-5-yl]sulfanylpropanamide |
| SMILES | CCNC(=O)NC(=O)C(C)Sc1nnnn1CC(C)C |
| InChI | InChI=1S/C11H20N6O2S/c1-5-12-10(19)13-9(18)8(4)20-11-14-15-16-17(11)6-7(2)3/h7-8H,5-6H2,1-4H3,(H2,12,13,18,19) |
| InChIKey | LIQLWRLVOXPJGZ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |