C15H19F2N5O2S — CID 51270329
N-[2-(difluoromethoxy)phenyl]-2-[1-(2-methylpropyl)tetrazol-5-yl]sulfanylpropanamide (PubChem CID 51270329) has the molecular formula C15H19F2N5O2S and a molecular weight of 371.41 g/mol. Its IUPAC name is N-[2-(difluoromethoxy)phenyl]-2-[1-(2-methylpropyl)tetrazol-5-yl]sulfanylpropanamide.
| Compound Name | N-[2-(difluoromethoxy)phenyl]-2-[1-(2-methylpropyl)tetrazol-5-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 51270329 |
| Molecular Formula | C15H19F2N5O2S |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | N-[2-(difluoromethoxy)phenyl]-2-[1-(2-methylpropyl)tetrazol-5-yl]sulfanylpropanamide |
| SMILES | CC(C)Cn1nnnc1SC(C)C(=O)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C15H19F2N5O2S/c1-9(2)8-22-15(19-20-21-22)25-10(3)13(23)18-11-6-4-5-7-12(11)24-14(16)17/h4-7,9-10,14H,8H2,1-3H3,(H,18,23) |
| InChIKey | KYDUZDXYIBWGBN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |