C16H23N5OS — CID 51270313
2-[1-(2-methylpropyl)tetrazol-5-yl]sulfanyl-N-(2-phenylethyl)propanamide (PubChem CID 51270313) has the molecular formula C16H23N5OS and a molecular weight of 333.46 g/mol. Its IUPAC name is 2-[1-(2-methylpropyl)tetrazol-5-yl]sulfanyl-N-(2-phenylethyl)propanamide.
| Compound Name | 2-[1-(2-methylpropyl)tetrazol-5-yl]sulfanyl-N-(2-phenylethyl)propanamide |
|---|---|
| PubChem CID | 51270313 |
| Molecular Formula | C16H23N5OS |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 2-[1-(2-methylpropyl)tetrazol-5-yl]sulfanyl-N-(2-phenylethyl)propanamide |
| SMILES | CC(C)Cn1nnnc1SC(C)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C16H23N5OS/c1-12(2)11-21-16(18-19-20-21)23-13(3)15(22)17-10-9-14-7-5-4-6-8-14/h4-8,12-13H,9-11H2,1-3H3,(H,17,22) |
| InChIKey | KQUMYLKZEFJULF-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |