C17H25N5O3S2 — CID 56529205
N-methyl-3-[[4-(4-methylphenyl)-5-morpholin-4-yl-1,2,4-triazol-3-yl]sulfanyl]propane-1-sulfonamide (PubChem CID 56529205) has the molecular formula C17H25N5O3S2 and a molecular weight of 411.55 g/mol. Its IUPAC name is N-methyl-3-[[4-(4-methylphenyl)-5-morpholin-4-yl-1,2,4-triazol-3-yl]sulfanyl]propane-1-sulfonamide.
| Compound Name | N-methyl-3-[[4-(4-methylphenyl)-5-morpholin-4-yl-1,2,4-triazol-3-yl]sulfanyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 56529205 |
| Molecular Formula | C17H25N5O3S2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | N-methyl-3-[[4-(4-methylphenyl)-5-morpholin-4-yl-1,2,4-triazol-3-yl]sulfanyl]propane-1-sulfonamide |
| SMILES | CNS(=O)(=O)CCCSc1nnc(N2CCOCC2)n1-c1ccc(C)cc1 |
| InChI | InChI=1S/C17H25N5O3S2/c1-14-4-6-15(7-5-14)22-16(21-8-10-25-11-9-21)19-20-17(22)26-12-3-13-27(23,24)18-2/h4-7,18H,3,8-13H2,1-2H3 |
| InChIKey | JXHNFHCOZSMNIB-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|