C19H21FN4O2S2 — CID 56528995
3-[[5-(2-fluorophenyl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-methylpropane-1-sulfonamide (PubChem CID 56528995) has the molecular formula C19H21FN4O2S2 and a molecular weight of 420.54 g/mol. Its IUPAC name is 3-[[5-(2-fluorophenyl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-methylpropane-1-sulfonamide.
| Compound Name | 3-[[5-(2-fluorophenyl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-methylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 56528995 |
| Molecular Formula | C19H21FN4O2S2 |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 3-[[5-(2-fluorophenyl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-methylpropane-1-sulfonamide |
| SMILES | CNS(=O)(=O)CCCSc1nnc(-c2ccccc2F)n1-c1ccc(C)cc1 |
| InChI | InChI=1S/C19H21FN4O2S2/c1-14-8-10-15(11-9-14)24-18(16-6-3-4-7-17(16)20)22-23-19(24)27-12-5-13-28(25,26)21-2/h3-4,6-11,21H,5,12-13H2,1-2H3 |
| InChIKey | HXFJIZJVXCRSGD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|