C20H18FN5O2S — CID 35359309
3-[2-[[5-(2-fluorophenyl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]ethyl]imidazolidine-2,4-dione (PubChem CID 35359309) has the molecular formula C20H18FN5O2S and a molecular weight of 411.46 g/mol. Its IUPAC name is 3-[2-[[5-(2-fluorophenyl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]ethyl]imidazolidine-2,4-dione.
| Compound Name | 3-[2-[[5-(2-fluorophenyl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 35359309 |
| Molecular Formula | C20H18FN5O2S |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 3-[2-[[5-(2-fluorophenyl)-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]ethyl]imidazolidine-2,4-dione |
| SMILES | Cc1ccc(-n2c(SCCN3C(=O)CNC3=O)nnc2-c2ccccc2F)cc1 |
| InChI | InChI=1S/C20H18FN5O2S/c1-13-6-8-14(9-7-13)26-18(15-4-2-3-5-16(15)21)23-24-20(26)29-11-10-25-17(27)12-22-19(25)28/h2-9H,10-12H2,1H3,(H,22,28) |
| InChIKey | BYHGRDGFTHNAGK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|