C20H18FN5O2S — CID 55996229
3-[3-[[5-(4-fluorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propyl]imidazolidine-2,4-dione (PubChem CID 55996229) has the molecular formula C20H18FN5O2S and a molecular weight of 411.46 g/mol. Its IUPAC name is 3-[3-[[5-(4-fluorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propyl]imidazolidine-2,4-dione.
| Compound Name | 3-[3-[[5-(4-fluorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 55996229 |
| Molecular Formula | C20H18FN5O2S |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 3-[3-[[5-(4-fluorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propyl]imidazolidine-2,4-dione |
| SMILES | O=C1CNC(=O)N1CCCSc1nnc(-c2ccc(F)cc2)n1-c1ccccc1 |
| InChI | InChI=1S/C20H18FN5O2S/c21-15-9-7-14(8-10-15)18-23-24-20(26(18)16-5-2-1-3-6-16)29-12-4-11-25-17(27)13-22-19(25)28/h1-3,5-10H,4,11-13H2,(H,22,28) |
| InChIKey | XMSOYTOFKJOKJE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|