C20H16F2N4O3S — CID 55856071
3-[3-[3-(2,4-difluorophenyl)-4-oxoquinazolin-2-yl]sulfanylpropyl]imidazolidine-2,4-dione (PubChem CID 55856071) has the molecular formula C20H16F2N4O3S and a molecular weight of 430.44 g/mol. Its IUPAC name is 3-[3-[3-(2,4-difluorophenyl)-4-oxoquinazolin-2-yl]sulfanylpropyl]imidazolidine-2,4-dione.
| Compound Name | 3-[3-[3-(2,4-difluorophenyl)-4-oxoquinazolin-2-yl]sulfanylpropyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 55856071 |
| Molecular Formula | C20H16F2N4O3S |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 3-[3-[3-(2,4-difluorophenyl)-4-oxoquinazolin-2-yl]sulfanylpropyl]imidazolidine-2,4-dione |
| SMILES | O=C1CNC(=O)N1CCCSc1nc2ccccc2c(=O)n1-c1ccc(F)cc1F |
| InChI | InChI=1S/C20H16F2N4O3S/c21-12-6-7-16(14(22)10-12)26-18(28)13-4-1-2-5-15(13)24-20(26)30-9-3-8-25-17(27)11-23-19(25)29/h1-2,4-7,10H,3,8-9,11H2,(H,23,29) |
| InChIKey | RUWBZXVIXCJAOJ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|