C20H15ClF2N4O3S — CID 55996611
3-[3-[6-chloro-3-(2,4-difluorophenyl)-4-oxoquinazolin-2-yl]sulfanylpropyl]imidazolidine-2,4-dione (PubChem CID 55996611) has the molecular formula C20H15ClF2N4O3S and a molecular weight of 464.88 g/mol. Its IUPAC name is 3-[3-[6-chloro-3-(2,4-difluorophenyl)-4-oxoquinazolin-2-yl]sulfanylpropyl]imidazolidine-2,4-dione.
| Compound Name | 3-[3-[6-chloro-3-(2,4-difluorophenyl)-4-oxoquinazolin-2-yl]sulfanylpropyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 55996611 |
| Molecular Formula | C20H15ClF2N4O3S |
| Molecular Weight | 464.88 g/mol |
| Exact Mass | 464.05 |
| IUPAC Name | 3-[3-[6-chloro-3-(2,4-difluorophenyl)-4-oxoquinazolin-2-yl]sulfanylpropyl]imidazolidine-2,4-dione |
| SMILES | O=C1CNC(=O)N1CCCSc1nc2ccc(Cl)cc2c(=O)n1-c1ccc(F)cc1F |
| InChI | InChI=1S/C20H15ClF2N4O3S/c21-11-2-4-15-13(8-11)18(29)27(16-5-3-12(22)9-14(16)23)20(25-15)31-7-1-6-26-17(28)10-24-19(26)30/h2-5,8-9H,1,6-7,10H2,(H,24,30) |
| InChIKey | LLOMBOREVHJFPF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.88 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|