C14H15BrN6O2S — CID 55998020
3-[3-[[4-amino-5-(2-bromophenyl)-1,2,4-triazol-3-yl]sulfanyl]propyl]imidazolidine-2,4-dione (PubChem CID 55998020) has the molecular formula C14H15BrN6O2S and a molecular weight of 411.29 g/mol. Its IUPAC name is 3-[3-[[4-amino-5-(2-bromophenyl)-1,2,4-triazol-3-yl]sulfanyl]propyl]imidazolidine-2,4-dione.
| Compound Name | 3-[3-[[4-amino-5-(2-bromophenyl)-1,2,4-triazol-3-yl]sulfanyl]propyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 55998020 |
| Molecular Formula | C14H15BrN6O2S |
| Molecular Weight | 411.29 g/mol |
| Exact Mass | 410.02 |
| IUPAC Name | 3-[3-[[4-amino-5-(2-bromophenyl)-1,2,4-triazol-3-yl]sulfanyl]propyl]imidazolidine-2,4-dione |
| SMILES | Nn1c(SCCCN2C(=O)CNC2=O)nnc1-c1ccccc1Br |
| InChI | InChI=1S/C14H15BrN6O2S/c15-10-5-2-1-4-9(10)12-18-19-14(21(12)16)24-7-3-6-20-11(22)8-17-13(20)23/h1-2,4-5H,3,6-8,16H2,(H,17,23) |
| InChIKey | QIHANXMUEQOBHK-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.29 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|