C18H23N5O3S — CID 60523055
3-[3-[[4-cyclohexyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]imidazolidine-2,4-dione (PubChem CID 60523055) has the molecular formula C18H23N5O3S and a molecular weight of 389.48 g/mol. Its IUPAC name is 3-[3-[[4-cyclohexyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]imidazolidine-2,4-dione.
| Compound Name | 3-[3-[[4-cyclohexyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 60523055 |
| Molecular Formula | C18H23N5O3S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 3-[3-[[4-cyclohexyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]imidazolidine-2,4-dione |
| SMILES | O=C1CNC(=O)N1CCCSc1nnc(-c2ccco2)n1C1CCCCC1 |
| InChI | InChI=1S/C18H23N5O3S/c24-15-12-19-17(25)22(15)9-5-11-27-18-21-20-16(14-8-4-10-26-14)23(18)13-6-2-1-3-7-13/h4,8,10,13H,1-3,5-7,9,11-12H2,(H,19,25) |
| InChIKey | KUPDAOOKJLVZQC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 93.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|