C14H15N5O3S — CID 39015346
3-[2-[[5-(furan-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]imidazolidine-2,4-dione (PubChem CID 39015346) has the molecular formula C14H15N5O3S and a molecular weight of 333.37 g/mol. Its IUPAC name is 3-[2-[[5-(furan-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]imidazolidine-2,4-dione.
| Compound Name | 3-[2-[[5-(furan-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 39015346 |
| Molecular Formula | C14H15N5O3S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 3-[2-[[5-(furan-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]imidazolidine-2,4-dione |
| SMILES | C=CCn1c(SCCN2C(=O)CNC2=O)nnc1-c1ccco1 |
| InChI | InChI=1S/C14H15N5O3S/c1-2-5-19-12(10-4-3-7-22-10)16-17-14(19)23-8-6-18-11(20)9-15-13(18)21/h2-4,7H,1,5-6,8-9H2,(H,15,21) |
| InChIKey | MLTZMBQYBJVHRG-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 93.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|