C19H19N3O3S2 — CID 56529514
S-[4-[[2-[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]acetyl]amino]phenyl] N,N-dimethylcarbamothioate (PubChem CID 56529514) has the molecular formula C19H19N3O3S2 and a molecular weight of 401.51 g/mol. Its IUPAC name is S-[4-[[2-[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]acetyl]amino]phenyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[4-[[2-[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]acetyl]amino]phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 56529514 |
| Molecular Formula | C19H19N3O3S2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | S-[4-[[2-[2-(5-methylfuran-2-yl)-1,3-thiazol-4-yl]acetyl]amino]phenyl] N,N-dimethylcarbamothioate |
| SMILES | Cc1ccc(-c2nc(CC(=O)Nc3ccc(SC(=O)N(C)C)cc3)cs2)o1 |
| InChI | InChI=1S/C19H19N3O3S2/c1-12-4-9-16(25-12)18-21-14(11-26-18)10-17(23)20-13-5-7-15(8-6-13)27-19(24)22(2)3/h4-9,11H,10H2,1-3H3,(H,20,23) |
| InChIKey | CTUWPPMXWXYMKB-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|