C14H18F3NO2S — CID 56529708
2,2,2-trifluoroethyl N-[2-(4-propan-2-ylphenyl)sulfanylethyl]carbamate (PubChem CID 56529708) has the molecular formula C14H18F3NO2S and a molecular weight of 321.36 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-[2-(4-propan-2-ylphenyl)sulfanylethyl]carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-[2-(4-propan-2-ylphenyl)sulfanylethyl]carbamate |
|---|---|
| PubChem CID | 56529708 |
| Molecular Formula | C14H18F3NO2S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 2,2,2-trifluoroethyl N-[2-(4-propan-2-ylphenyl)sulfanylethyl]carbamate |
| SMILES | CC(C)c1ccc(SCCNC(=O)OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H18F3NO2S/c1-10(2)11-3-5-12(6-4-11)21-8-7-18-13(19)20-9-14(15,16)17/h3-6,10H,7-9H2,1-2H3,(H,18,19) |
| InChIKey | XURVQXLBSZVWTC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|