C21H23FN4OS — CID 56531405
N-(3-tert-butyl-1-pyridin-2-ylpyrazol-5-yl)-3-(2-fluorophenyl)sulfanylpropanamide (PubChem CID 56531405) has the molecular formula C21H23FN4OS and a molecular weight of 398.51 g/mol. Its IUPAC name is N-(3-tert-butyl-1-pyridin-2-ylpyrazol-5-yl)-3-(2-fluorophenyl)sulfanylpropanamide.
| Compound Name | N-(3-tert-butyl-1-pyridin-2-ylpyrazol-5-yl)-3-(2-fluorophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 56531405 |
| Molecular Formula | C21H23FN4OS |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | N-(3-tert-butyl-1-pyridin-2-ylpyrazol-5-yl)-3-(2-fluorophenyl)sulfanylpropanamide |
| SMILES | CC(C)(C)c1cc(NC(=O)CCSc2ccccc2F)n(-c2ccccn2)n1 |
| InChI | InChI=1S/C21H23FN4OS/c1-21(2,3)17-14-19(26(25-17)18-10-6-7-12-23-18)24-20(27)11-13-28-16-9-5-4-8-15(16)22/h4-10,12,14H,11,13H2,1-3H3,(H,24,27) |
| InChIKey | NULQVXGQKFETKB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |