C17H23N5O3 — CID 122089728
4-[(3-tert-butyl-1-pyridin-2-ylpyrazol-5-yl)carbamoylamino]butanoic acid (PubChem CID 122089728) has the molecular formula C17H23N5O3 and a molecular weight of 345.40 g/mol. Its IUPAC name is 4-[(3-tert-butyl-1-pyridin-2-ylpyrazol-5-yl)carbamoylamino]butanoic acid.
| Compound Name | 4-[(3-tert-butyl-1-pyridin-2-ylpyrazol-5-yl)carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122089728 |
| Molecular Formula | C17H23N5O3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | 4-[(3-tert-butyl-1-pyridin-2-ylpyrazol-5-yl)carbamoylamino]butanoic acid |
| SMILES | CC(C)(C)c1cc(NC(=O)NCCCC(=O)O)n(-c2ccccn2)n1 |
| InChI | InChI=1S/C17H23N5O3/c1-17(2,3)12-11-14(20-16(25)19-10-6-8-15(23)24)22(21-12)13-7-4-5-9-18-13/h4-5,7,9,11H,6,8,10H2,1-3H3,(H,23,24)(H2,19,20,25) |
| InChIKey | POOGMFVJICZDAT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|