C18H23FN4O3 — CID 122075911
4-[[3-tert-butyl-1-(4-fluorophenyl)pyrazol-5-yl]carbamoylamino]butanoic acid (PubChem CID 122075911) has the molecular formula C18H23FN4O3 and a molecular weight of 362.41 g/mol. Its IUPAC name is 4-[[3-tert-butyl-1-(4-fluorophenyl)pyrazol-5-yl]carbamoylamino]butanoic acid.
| Compound Name | 4-[[3-tert-butyl-1-(4-fluorophenyl)pyrazol-5-yl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122075911 |
| Molecular Formula | C18H23FN4O3 |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 4-[[3-tert-butyl-1-(4-fluorophenyl)pyrazol-5-yl]carbamoylamino]butanoic acid |
| SMILES | CC(C)(C)c1cc(NC(=O)NCCCC(=O)O)n(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C18H23FN4O3/c1-18(2,3)14-11-15(21-17(26)20-10-4-5-16(24)25)23(22-14)13-8-6-12(19)7-9-13/h6-9,11H,4-5,10H2,1-3H3,(H,24,25)(H2,20,21,26) |
| InChIKey | FNNQIACMMAXFFI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|