C14H18FN3 — CID 137395749
3-tert-butyl-1-(4-fluorophenyl)-N-methylpyrazol-5-amine (PubChem CID 137395749) has the molecular formula C14H18FN3 and a molecular weight of 247.32 g/mol. Its IUPAC name is 3-tert-butyl-1-(4-fluorophenyl)-N-methylpyrazol-5-amine.
| Compound Name | 3-tert-butyl-1-(4-fluorophenyl)-N-methylpyrazol-5-amine |
|---|---|
| PubChem CID | 137395749 |
| Molecular Formula | C14H18FN3 |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | 3-tert-butyl-1-(4-fluorophenyl)-N-methylpyrazol-5-amine |
| SMILES | CNc1cc(C(C)(C)C)nn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C14H18FN3/c1-14(2,3)12-9-13(16-4)18(17-12)11-7-5-10(15)6-8-11/h5-9,16H,1-4H3 |
| InChIKey | KAPNELYSGWIMIZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |