C21H30FN5O — CID 126768402
N-[3-tert-butyl-1-(4-fluorophenyl)pyrazol-5-yl]-4-(dimethylamino)piperidine-1-carboxamide (PubChem CID 126768402) has the molecular formula C21H30FN5O and a molecular weight of 387.50 g/mol. Its IUPAC name is N-[3-tert-butyl-1-(4-fluorophenyl)pyrazol-5-yl]-4-(dimethylamino)piperidine-1-carboxamide.
| Compound Name | N-[3-tert-butyl-1-(4-fluorophenyl)pyrazol-5-yl]-4-(dimethylamino)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 126768402 |
| Molecular Formula | C21H30FN5O |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | N-[3-tert-butyl-1-(4-fluorophenyl)pyrazol-5-yl]-4-(dimethylamino)piperidine-1-carboxamide |
| SMILES | CN(C)C1CCN(C(=O)Nc2cc(C(C)(C)C)nn2-c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H30FN5O/c1-21(2,3)18-14-19(27(24-18)17-8-6-15(22)7-9-17)23-20(28)26-12-10-16(11-13-26)25(4)5/h6-9,14,16H,10-13H2,1-5H3,(H,23,28) |
| InChIKey | WDUPXSOVKPTNNJ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |