C21H25N7O — CID 56532355
(E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-(3-piperidin-1-yl-1H-1,2,4-triazol-5-yl)prop-2-enamide (PubChem CID 56532355) has the molecular formula C21H25N7O and a molecular weight of 391.48 g/mol. Its IUPAC name is (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-(3-piperidin-1-yl-1H-1,2,4-triazol-5-yl)prop-2-enamide.
| Compound Name | (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-(3-piperidin-1-yl-1H-1,2,4-triazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 56532355 |
| Molecular Formula | C21H25N7O |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-(3-piperidin-1-yl-1H-1,2,4-triazol-5-yl)prop-2-enamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1/C=C/C(=O)Nc1nc(N2CCCCC2)n[nH]1 |
| InChI | InChI=1S/C21H25N7O/c1-15-18(16(2)28(26-15)17-9-5-3-6-10-17)11-12-19(29)22-20-23-21(25-24-20)27-13-7-4-8-14-27/h3,5-6,9-12H,4,7-8,13-14H2,1-2H3,(H2,22,23,24,25,29)/b12-11+ |
| InChIKey | LQOAMCLKLBMCMF-VAWYXSNFSA-N |
| XLogP | 3.25 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|