C23H21N5O5 — CID 56534566
N-(2-cyanoethyl)-N-(4-ethoxyphenyl)-6-methyl-1-(2-nitrophenyl)-4-oxopyridazine-3-carboxamide (PubChem CID 56534566) has the molecular formula C23H21N5O5 and a molecular weight of 447.45 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N-(4-ethoxyphenyl)-6-methyl-1-(2-nitrophenyl)-4-oxopyridazine-3-carboxamide.
| Compound Name | N-(2-cyanoethyl)-N-(4-ethoxyphenyl)-6-methyl-1-(2-nitrophenyl)-4-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 56534566 |
| Molecular Formula | C23H21N5O5 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | N-(2-cyanoethyl)-N-(4-ethoxyphenyl)-6-methyl-1-(2-nitrophenyl)-4-oxopyridazine-3-carboxamide |
| SMILES | CCOc1ccc(N(CCC#N)C(=O)c2nn(-c3ccccc3[N+](=O)[O-])c(C)cc2=O)cc1 |
| InChI | InChI=1S/C23H21N5O5/c1-3-33-18-11-9-17(10-12-18)26(14-6-13-24)23(30)22-21(29)15-16(2)27(25-22)19-7-4-5-8-20(19)28(31)32/h4-5,7-12,15H,3,6,14H2,1-2H3 |
| InChIKey | KEQYBKYHGNJGLW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 131.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|