C23H25N3O4 — CID 56534680
1-(furan-3-carbonyl)-N-(3-quinolin-8-yloxypropyl)piperidine-4-carboxamide (PubChem CID 56534680) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is 1-(furan-3-carbonyl)-N-(3-quinolin-8-yloxypropyl)piperidine-4-carboxamide.
| Compound Name | 1-(furan-3-carbonyl)-N-(3-quinolin-8-yloxypropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 56534680 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 1-(furan-3-carbonyl)-N-(3-quinolin-8-yloxypropyl)piperidine-4-carboxamide |
| SMILES | O=C(NCCCOc1cccc2cccnc12)C1CCN(C(=O)c2ccoc2)CC1 |
| InChI | InChI=1S/C23H25N3O4/c27-22(18-7-12-26(13-8-18)23(28)19-9-15-29-16-19)25-11-3-14-30-20-6-1-4-17-5-2-10-24-21(17)20/h1-2,4-6,9-10,15-16,18H,3,7-8,11-14H2,(H,25,27) |
| InChIKey | HDSXDHDONBPYOO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|