C21H17ClF2N4O — CID 56537354
(2-chloro-4,5-difluorophenyl)-[4-(2-phenylpyrimidin-4-yl)piperazin-1-yl]methanone (PubChem CID 56537354) has the molecular formula C21H17ClF2N4O and a molecular weight of 414.84 g/mol. Its IUPAC name is (2-chloro-4,5-difluorophenyl)-[4-(2-phenylpyrimidin-4-yl)piperazin-1-yl]methanone.
| Compound Name | (2-chloro-4,5-difluorophenyl)-[4-(2-phenylpyrimidin-4-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 56537354 |
| Molecular Formula | C21H17ClF2N4O |
| Molecular Weight | 414.84 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | (2-chloro-4,5-difluorophenyl)-[4-(2-phenylpyrimidin-4-yl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cc(F)c(F)cc1Cl)N1CCN(c2ccnc(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C21H17ClF2N4O/c22-16-13-18(24)17(23)12-15(16)21(29)28-10-8-27(9-11-28)19-6-7-25-20(26-19)14-4-2-1-3-5-14/h1-7,12-13H,8-11H2 |
| InChIKey | ORIZUNAUDNZAHD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.84 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|