C21H18ClFN4O — CID 56527948
(5-chloro-2-fluorophenyl)-[4-(2-phenylpyrimidin-4-yl)piperazin-1-yl]methanone (PubChem CID 56527948) has the molecular formula C21H18ClFN4O and a molecular weight of 396.85 g/mol. Its IUPAC name is (5-chloro-2-fluorophenyl)-[4-(2-phenylpyrimidin-4-yl)piperazin-1-yl]methanone.
| Compound Name | (5-chloro-2-fluorophenyl)-[4-(2-phenylpyrimidin-4-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 56527948 |
| Molecular Formula | C21H18ClFN4O |
| Molecular Weight | 396.85 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | (5-chloro-2-fluorophenyl)-[4-(2-phenylpyrimidin-4-yl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cc(Cl)ccc1F)N1CCN(c2ccnc(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C21H18ClFN4O/c22-16-6-7-18(23)17(14-16)21(28)27-12-10-26(11-13-27)19-8-9-24-20(25-19)15-4-2-1-3-5-15/h1-9,14H,10-13H2 |
| InChIKey | FMZATJQSKQIQIG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.85 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |