C19H21N5OS2 — CID 56538042
N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-2-pyrrol-1-yl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 56538042) has the molecular formula C19H21N5OS2 and a molecular weight of 399.55 g/mol. Its IUPAC name is N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-2-pyrrol-1-yl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-2-pyrrol-1-yl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 56538042 |
| Molecular Formula | C19H21N5OS2 |
| Molecular Weight | 399.55 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-2-pyrrol-1-yl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | O=C(NCc1n[nH]c(=S)n1C1CC1)c1c(-n2cccc2)sc2c1CCCC2 |
| InChI | InChI=1S/C19H21N5OS2/c25-17(20-11-15-21-22-19(26)24(15)12-7-8-12)16-13-5-1-2-6-14(13)27-18(16)23-9-3-4-10-23/h3-4,9-10,12H,1-2,5-8,11H2,(H,20,25)(H,22,26) |
| InChIKey | POZAAQIOSVZVAO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.55 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|