C19H26N2O4S2 — CID 56541430
N-[2-methyl-2-(1-phenylethylamino)propyl]-2-methylsulfonylbenzenesulfonamide (PubChem CID 56541430) has the molecular formula C19H26N2O4S2 and a molecular weight of 410.56 g/mol. Its IUPAC name is N-[2-methyl-2-(1-phenylethylamino)propyl]-2-methylsulfonylbenzenesulfonamide.
| Compound Name | N-[2-methyl-2-(1-phenylethylamino)propyl]-2-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 56541430 |
| Molecular Formula | C19H26N2O4S2 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | N-[2-methyl-2-(1-phenylethylamino)propyl]-2-methylsulfonylbenzenesulfonamide |
| SMILES | CC(NC(C)(C)CNS(=O)(=O)c1ccccc1S(C)(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C19H26N2O4S2/c1-15(16-10-6-5-7-11-16)21-19(2,3)14-20-27(24,25)18-13-9-8-12-17(18)26(4,22)23/h5-13,15,20-21H,14H2,1-4H3 |
| InChIKey | NBIOXJRGAGHOOC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |