C20H28N2O2S — CID 56541912
4-ethyl-N-[2-methyl-2-(1-phenylethylamino)propyl]benzenesulfonamide (PubChem CID 56541912) has the molecular formula C20H28N2O2S and a molecular weight of 360.52 g/mol. Its IUPAC name is 4-ethyl-N-[2-methyl-2-(1-phenylethylamino)propyl]benzenesulfonamide.
| Compound Name | 4-ethyl-N-[2-methyl-2-(1-phenylethylamino)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 56541912 |
| Molecular Formula | C20H28N2O2S |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | 4-ethyl-N-[2-methyl-2-(1-phenylethylamino)propyl]benzenesulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)NCC(C)(C)NC(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H28N2O2S/c1-5-17-11-13-19(14-12-17)25(23,24)21-15-20(3,4)22-16(2)18-9-7-6-8-10-18/h6-14,16,21-22H,5,15H2,1-4H3 |
| InChIKey | XUXDNSGCJKRTRS-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |