C20H23ClN2O5 — CID 56542104
methyl 2-[[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]amino]-2-methyl-3-phenoxypropanoate (PubChem CID 56542104) has the molecular formula C20H23ClN2O5 and a molecular weight of 406.87 g/mol. Its IUPAC name is methyl 2-[[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]amino]-2-methyl-3-phenoxypropanoate.
| Compound Name | methyl 2-[[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]amino]-2-methyl-3-phenoxypropanoate |
|---|---|
| PubChem CID | 56542104 |
| Molecular Formula | C20H23ClN2O5 |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | methyl 2-[[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]amino]-2-methyl-3-phenoxypropanoate |
| SMILES | COC(=O)C(C)(COc1ccccc1)NCC(=O)Nc1cc(Cl)ccc1OC |
| InChI | InChI=1S/C20H23ClN2O5/c1-20(19(25)27-3,13-28-15-7-5-4-6-8-15)22-12-18(24)23-16-11-14(21)9-10-17(16)26-2/h4-11,22H,12-13H2,1-3H3,(H,23,24) |
| InChIKey | AINRBQYMDFLWGO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |