C24H32N4O4 — CID 56542624
3-[benzyl(1-morpholin-4-ylpropan-2-yl)amino]-N-(2-methyl-4-nitrophenyl)propanamide (PubChem CID 56542624) has the molecular formula C24H32N4O4 and a molecular weight of 440.54 g/mol. Its IUPAC name is 3-[benzyl(1-morpholin-4-ylpropan-2-yl)amino]-N-(2-methyl-4-nitrophenyl)propanamide.
| Compound Name | 3-[benzyl(1-morpholin-4-ylpropan-2-yl)amino]-N-(2-methyl-4-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 56542624 |
| Molecular Formula | C24H32N4O4 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | 3-[benzyl(1-morpholin-4-ylpropan-2-yl)amino]-N-(2-methyl-4-nitrophenyl)propanamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)CCN(Cc1ccccc1)C(C)CN1CCOCC1 |
| InChI | InChI=1S/C24H32N4O4/c1-19-16-22(28(30)31)8-9-23(19)25-24(29)10-11-27(18-21-6-4-3-5-7-21)20(2)17-26-12-14-32-15-13-26/h3-9,16,20H,10-15,17-18H2,1-2H3,(H,25,29) |
| InChIKey | IVLFZBWBRALFAG-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|