C19H22N2O7S — CID 56543378
methyl 2-hydroxy-3-[[4-methoxy-3-(propan-2-ylsulfamoyl)benzoyl]amino]benzoate (PubChem CID 56543378) has the molecular formula C19H22N2O7S and a molecular weight of 422.46 g/mol. Its IUPAC name is methyl 2-hydroxy-3-[[4-methoxy-3-(propan-2-ylsulfamoyl)benzoyl]amino]benzoate.
| Compound Name | methyl 2-hydroxy-3-[[4-methoxy-3-(propan-2-ylsulfamoyl)benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 56543378 |
| Molecular Formula | C19H22N2O7S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | methyl 2-hydroxy-3-[[4-methoxy-3-(propan-2-ylsulfamoyl)benzoyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2ccc(OC)c(S(=O)(=O)NC(C)C)c2)c1O |
| InChI | InChI=1S/C19H22N2O7S/c1-11(2)21-29(25,26)16-10-12(8-9-15(16)27-3)18(23)20-14-7-5-6-13(17(14)22)19(24)28-4/h5-11,21-22H,1-4H3,(H,20,23) |
| InChIKey | MOACGYVBAYEKNQ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|