C25H23N3O2S — CID 56544298
S-[4-[(1-benzylindole-2-carbonyl)amino]phenyl] N,N-dimethylcarbamothioate (PubChem CID 56544298) has the molecular formula C25H23N3O2S and a molecular weight of 429.55 g/mol. Its IUPAC name is S-[4-[(1-benzylindole-2-carbonyl)amino]phenyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[4-[(1-benzylindole-2-carbonyl)amino]phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 56544298 |
| Molecular Formula | C25H23N3O2S |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | S-[4-[(1-benzylindole-2-carbonyl)amino]phenyl] N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=O)Sc1ccc(NC(=O)c2cc3ccccc3n2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C25H23N3O2S/c1-27(2)25(30)31-21-14-12-20(13-15-21)26-24(29)23-16-19-10-6-7-11-22(19)28(23)17-18-8-4-3-5-9-18/h3-16H,17H2,1-2H3,(H,26,29) |
| InChIKey | NMJDSXOVQQVSHB-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|