C30H50OS — CID 565448
S-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-2-yl]methyl] ethanethioate (PubChem CID 565448) has the molecular formula C30H50OS and a molecular weight of 458.80 g/mol. Its IUPAC name is S-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-2-yl]methyl] ethanethioate.
| Compound Name | S-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-2-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 565448 |
| Molecular Formula | C30H50OS |
| Molecular Weight | 458.80 g/mol |
| Exact Mass | 458.36 |
| IUPAC Name | S-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-2-yl]methyl] ethanethioate |
| SMILES | CC(=O)SCC1=CCC2CCC3C(CCC4(C)C(C(C)CCCC(C)C)CCC34)C2(C)C1 |
| InChI | InChI=1S/C30H50OS/c1-20(2)8-7-9-21(3)26-14-15-27-25-13-12-24-11-10-23(19-32-22(4)31)18-30(24,6)28(25)16-17-29(26,27)5/h10,20-21,24-28H,7-9,11-19H2,1-6H3 |
| InChIKey | VFWCTYXSVGECFG-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.80 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|