C17H23BrN2O5S — CID 56544996
4-(2-bromophenoxy)-N-[1-(1,1-dioxo-1,4-thiazinan-4-yl)-1-oxopropan-2-yl]butanamide (PubChem CID 56544996) has the molecular formula C17H23BrN2O5S and a molecular weight of 447.35 g/mol. Its IUPAC name is 4-(2-bromophenoxy)-N-[1-(1,1-dioxo-1,4-thiazinan-4-yl)-1-oxopropan-2-yl]butanamide.
| Compound Name | 4-(2-bromophenoxy)-N-[1-(1,1-dioxo-1,4-thiazinan-4-yl)-1-oxopropan-2-yl]butanamide |
|---|---|
| PubChem CID | 56544996 |
| Molecular Formula | C17H23BrN2O5S |
| Molecular Weight | 447.35 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | 4-(2-bromophenoxy)-N-[1-(1,1-dioxo-1,4-thiazinan-4-yl)-1-oxopropan-2-yl]butanamide |
| SMILES | CC(NC(=O)CCCOc1ccccc1Br)C(=O)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C17H23BrN2O5S/c1-13(17(22)20-8-11-26(23,24)12-9-20)19-16(21)7-4-10-25-15-6-3-2-5-14(15)18/h2-3,5-6,13H,4,7-12H2,1H3,(H,19,21) |
| InChIKey | DJEJIYSZSCMEPD-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.35 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|