C17H26BrNO3 — CID 75391466
4-(2-bromophenoxy)-N-(6-hydroxy-5-methylhexan-3-yl)butanamide (PubChem CID 75391466) has the molecular formula C17H26BrNO3 and a molecular weight of 372.30 g/mol. Its IUPAC name is 4-(2-bromophenoxy)-N-(6-hydroxy-5-methylhexan-3-yl)butanamide.
| Compound Name | 4-(2-bromophenoxy)-N-(6-hydroxy-5-methylhexan-3-yl)butanamide |
|---|---|
| PubChem CID | 75391466 |
| Molecular Formula | C17H26BrNO3 |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 4-(2-bromophenoxy)-N-(6-hydroxy-5-methylhexan-3-yl)butanamide |
| SMILES | CCC(CC(C)CO)NC(=O)CCCOc1ccccc1Br |
| InChI | InChI=1S/C17H26BrNO3/c1-3-14(11-13(2)12-20)19-17(21)9-6-10-22-16-8-5-4-7-15(16)18/h4-5,7-8,13-14,20H,3,6,9-12H2,1-2H3,(H,19,21) |
| InChIKey | WSBPBKPSJVYFQQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|